About ethane;3-methyl-2,3-dihydro-1H-pyrazolo[4,3-b]pyridine
ethane;3-methyl-2,3-dihydro-1H-pyrazolo[4,3-b]pyridine (PubChem CID 145249796) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is ethane;3-methyl-2,3-dihydro-1H-pyrazolo[4,3-b]pyridine.
Analyze ethane;3-methyl-2,3-dihydro-1H-pyrazolo[4,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-2,3-dihydro-1H-pyrazolo[4,3-b]pyridine?
The IUPAC name of ethane;3-methyl-2,3-dihydro-1H-pyrazolo[4,3-b]pyridine (CID 145249796) is ethane;3-methyl-2,3-dihydro-1H-pyrazolo[4,3-b]pyridine.
What is the SMILES notation for ethane;3-methyl-2,3-dihydro-1H-pyrazolo[4,3-b]pyridine?
The canonical SMILES for ethane;3-methyl-2,3-dihydro-1H-pyrazolo[4,3-b]pyridine is CC.CC1NNc2cccnc21.
What is the InChIKey of ethane;3-methyl-2,3-dihydro-1H-pyrazolo[4,3-b]pyridine?
The InChIKey is FIWQUMQTYYJWGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3.C2H6/c1-5-7-6(10-9-5)3-2-4-8-7;1-2/h2-5,9-10H,1H3;1-2H3.
What are the key properties of ethane;3-methyl-2,3-dihydro-1H-pyrazolo[4,3-b]pyridine?
ethane;3-methyl-2,3-dihydro-1H-pyrazolo[4,3-b]pyridine has a molecular weight of 165.24 g/mol, XLogP of 2.10, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-2,3-dihydro-1H-pyrazolo[4,3-b]pyridine is sourced from PubChem (CID 145249796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).