C33H31N5OS — CID 145250567
N-[5-[3-[4-(5-methylthiophen-2-yl)-1,8-dihydrocyclohepta[b]pyrrol-2-yl]-2H-pyrazolo[3,4-b]pyridin-5-yl]-3-bicyclo[5.1.0]octa-1,3,5-trienyl]pentanamide (PubChem CID 145250567) has the molecular formula C33H31N5OS and a molecular weight of 545.71 g/mol. Its IUPAC name is N-[5-[3-[4-(5-methylthiophen-2-yl)-1,8-dihydrocyclohepta[b]pyrrol-2-yl]-2H-pyrazolo[3,4-b]pyridin-5-yl]-3-bicyclo[5.1.0]octa-1,3,5-trienyl]pentanamide.
| Compound Name | N-[5-[3-[4-(5-methylthiophen-2-yl)-1,8-dihydrocyclohepta[b]pyrrol-2-yl]-2H-pyrazolo[3,4-b]pyridin-5-yl]-3-bicyclo[5.1.0]octa-1,3,5-trienyl]pentanamide |
|---|---|
| PubChem CID | 145250567 |
| Molecular Formula | C33H31N5OS |
| Molecular Weight | 545.71 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | N-[5-[3-[4-(5-methylthiophen-2-yl)-1,8-dihydrocyclohepta[b]pyrrol-2-yl]-2H-pyrazolo[3,4-b]pyridin-5-yl]-3-bicyclo[5.1.0]octa-1,3,5-trienyl]pentanamide |
| SMILES | CCCCC(=O)NC1=CC(c2cnc3n[nH]c(-c4cc5c([nH]4)CC=CC=C5c4ccc(C)s4)c3c2)=CC2CC2=C1 |
| InChI | InChI=1S/C33H31N5OS/c1-3-4-9-31(39)35-24-14-21-12-20(21)13-22(15-24)23-16-27-32(37-38-33(27)34-18-23)29-17-26-25(30-11-10-19(2)40-30)7-5-6-8-28(26)36-29/h5-7,10-11,13-18,20,36H,3-4,8-9,12H2,1-2H3,(H,35,39)(H,34,37,38) |
| InChIKey | FOLRGLMDZFRXST-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.71 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |