C32H33N5O2 — CID 145254204
2-[4-(furan-3-yl)-7-methyl-1,8-dihydrocyclohepta[b]pyrrole-2-carboximidoyl]-4-[5-(2-pyrrolidin-1-ylethoxy)-3-pyridinyl]aniline (PubChem CID 145254204) has the molecular formula C32H33N5O2 and a molecular weight of 519.65 g/mol. Its IUPAC name is 2-[4-(furan-3-yl)-7-methyl-1,8-dihydrocyclohepta[b]pyrrole-2-carboximidoyl]-4-[5-(2-pyrrolidin-1-ylethoxy)-3-pyridinyl]aniline.
| Compound Name | 2-[4-(furan-3-yl)-7-methyl-1,8-dihydrocyclohepta[b]pyrrole-2-carboximidoyl]-4-[5-(2-pyrrolidin-1-ylethoxy)-3-pyridinyl]aniline |
|---|---|
| PubChem CID | 145254204 |
| Molecular Formula | C32H33N5O2 |
| Molecular Weight | 519.65 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 2-[4-(furan-3-yl)-7-methyl-1,8-dihydrocyclohepta[b]pyrrole-2-carboximidoyl]-4-[5-(2-pyrrolidin-1-ylethoxy)-3-pyridinyl]aniline |
| SMILES | [H]/N=C(\c1cc2c([nH]1)CC(C)=CC=C2c1ccoc1)c1cc(-c2cncc(OCCN3CCCC3)c2)ccc1N |
| InChI | InChI=1S/C32H33N5O2/c1-21-4-6-26(23-8-12-38-20-23)27-17-31(36-30(27)14-21)32(34)28-16-22(5-7-29(28)33)24-15-25(19-35-18-24)39-13-11-37-9-2-3-10-37/h4-8,12,15-20,34,36H,2-3,9-11,13-14,33H2,1H3/b34-32- |
| InChIKey | HLNGVBPFWJZSBM-YJKCNMNRSA-N |
| XLogP | 6.08 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.65 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|