C14H26O — CID 145255082
[1-methyl-2-[(2R)-2,3,3,4-tetramethylpent-4-enyl]cyclopropyl]methanol (PubChem CID 145255082) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is [1-methyl-2-[(2R)-2,3,3,4-tetramethylpent-4-enyl]cyclopropyl]methanol.
| Compound Name | [1-methyl-2-[(2R)-2,3,3,4-tetramethylpent-4-enyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 145255082 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | [1-methyl-2-[(2R)-2,3,3,4-tetramethylpent-4-enyl]cyclopropyl]methanol |
| SMILES | C=C(C)C(C)(C)[C@H](C)CC1CC1(C)CO |
| InChI | InChI=1S/C14H26O/c1-10(2)13(4,5)11(3)7-12-8-14(12,6)9-15/h11-12,15H,1,7-9H2,2-6H3/t11-,12?,14?/m1/s1 |
| InChIKey | HTVFLAQLZQOTCN-LKSINWNRSA-N |
| XLogP | 3.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|