C22H26Cl2N2O4 — CID 145255559
tert-butyl 3,4-dihydroxypiperidine-1-carboxylate;3,6-dichloro-9H-carbazole (PubChem CID 145255559) has the molecular formula C22H26Cl2N2O4 and a molecular weight of 453.37 g/mol. Its IUPAC name is tert-butyl 3,4-dihydroxypiperidine-1-carboxylate;3,6-dichloro-9H-carbazole.
| Compound Name | tert-butyl 3,4-dihydroxypiperidine-1-carboxylate;3,6-dichloro-9H-carbazole |
|---|---|
| PubChem CID | 145255559 |
| Molecular Formula | C22H26Cl2N2O4 |
| Molecular Weight | 453.37 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | tert-butyl 3,4-dihydroxypiperidine-1-carboxylate;3,6-dichloro-9H-carbazole |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)C(O)C1.Clc1ccc2[nH]c3ccc(Cl)cc3c2c1 |
| InChI | InChI=1S/C12H7Cl2N.C10H19NO4/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11;1-10(2,3)15-9(14)11-5-4-7(12)8(13)6-11/h1-6,15H;7-8,12-13H,4-6H2,1-3H3 |
| InChIKey | SCCWGDXKPRXTHL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |