About 1-[(3E)-hexa-1,3,5-trien-3-yl]-3-methylpiperazine
1-[(3E)-hexa-1,3,5-trien-3-yl]-3-methylpiperazine (PubChem CID 145255849) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 1-[(3E)-hexa-1,3,5-trien-3-yl]-3-methylpiperazine.
Molecular Properties
| Compound Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]-3-methylpiperazine |
| PubChem CID | 145255849 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]-3-methylpiperazine |
| SMILES | C=C/C=C(\C=C)N1CCNC(C)C1 |
| InChI | InChI=1S/C11H18N2/c1-4-6-11(5-2)13-8-7-12-10(3)9-13/h4-6,10,12H,1-2,7-9H2,3H3/b11-6+ |
| InChIKey | HNYDNVABWJGNPH-IZZDOVSWSA-N |
| XLogP | 1.54 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3E)-hexa-1,3,5-trien-3-yl]-3-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3E)-hexa-1,3,5-trien-3-yl]-3-methylpiperazine?
The IUPAC name of 1-[(3E)-hexa-1,3,5-trien-3-yl]-3-methylpiperazine (CID 145255849) is 1-[(3E)-hexa-1,3,5-trien-3-yl]-3-methylpiperazine.
What is the SMILES notation for 1-[(3E)-hexa-1,3,5-trien-3-yl]-3-methylpiperazine?
The canonical SMILES for 1-[(3E)-hexa-1,3,5-trien-3-yl]-3-methylpiperazine is C=C/C=C(\C=C)N1CCNC(C)C1.
What is the InChIKey of 1-[(3E)-hexa-1,3,5-trien-3-yl]-3-methylpiperazine?
The InChIKey is HNYDNVABWJGNPH-IZZDOVSWSA-N. The full InChI is InChI=1S/C11H18N2/c1-4-6-11(5-2)13-8-7-12-10(3)9-13/h4-6,10,12H,1-2,7-9H2,3H3/b11-6+.
What are the key properties of 1-[(3E)-hexa-1,3,5-trien-3-yl]-3-methylpiperazine?
1-[(3E)-hexa-1,3,5-trien-3-yl]-3-methylpiperazine has a molecular weight of 178.28 g/mol, XLogP of 1.54, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3E)-hexa-1,3,5-trien-3-yl]-3-methylpiperazine is sourced from PubChem (CID 145255849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).