About 1-methyl-2-prop-2-enylpiperidine-3,4-diimine
1-methyl-2-prop-2-enylpiperidine-3,4-diimine (PubChem CID 145255895) has the molecular formula C9H15N3
and a molecular weight of 165.24 g/mol. Its IUPAC name is 1-methyl-2-prop-2-enylpiperidine-3,4-diimine.
Molecular Properties
| Compound Name | 1-methyl-2-prop-2-enylpiperidine-3,4-diimine |
| PubChem CID | 145255895 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 1-methyl-2-prop-2-enylpiperidine-3,4-diimine |
| SMILES | [H]/N=C1C(=N\[H])\CCN(C)C\1CC=C |
| InChI | InChI=1S/C9H15N3/c1-3-4-8-9(11)7(10)5-6-12(8)2/h3,8,10-11H,1,4-6H2,2H3/b10-7+,11-9+ |
| InChIKey | KGZDIWLCZNOHDF-PPZOTWNKSA-N |
| XLogP | 1.31 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-prop-2-enylpiperidine-3,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-prop-2-enylpiperidine-3,4-diimine?
The IUPAC name of 1-methyl-2-prop-2-enylpiperidine-3,4-diimine (CID 145255895) is 1-methyl-2-prop-2-enylpiperidine-3,4-diimine.
What is the SMILES notation for 1-methyl-2-prop-2-enylpiperidine-3,4-diimine?
The canonical SMILES for 1-methyl-2-prop-2-enylpiperidine-3,4-diimine is [H]/N=C1C(=N\[H])\CCN(C)C\1CC=C.
What is the InChIKey of 1-methyl-2-prop-2-enylpiperidine-3,4-diimine?
The InChIKey is KGZDIWLCZNOHDF-PPZOTWNKSA-N. The full InChI is InChI=1S/C9H15N3/c1-3-4-8-9(11)7(10)5-6-12(8)2/h3,8,10-11H,1,4-6H2,2H3/b10-7+,11-9+.
What are the key properties of 1-methyl-2-prop-2-enylpiperidine-3,4-diimine?
1-methyl-2-prop-2-enylpiperidine-3,4-diimine has a molecular weight of 165.24 g/mol, XLogP of 1.31, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-prop-2-enylpiperidine-3,4-diimine is sourced from PubChem (CID 145255895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).