C10H13N3O — CID 145255947
1-(4-imino-2,3,8,8a-tetrahydro-1,5-naphthyridin-1-yl)ethanone (PubChem CID 145255947) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 1-(4-imino-2,3,8,8a-tetrahydro-1,5-naphthyridin-1-yl)ethanone.
| Compound Name | 1-(4-imino-2,3,8,8a-tetrahydro-1,5-naphthyridin-1-yl)ethanone |
|---|---|
| PubChem CID | 145255947 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 1-(4-imino-2,3,8,8a-tetrahydro-1,5-naphthyridin-1-yl)ethanone |
| SMILES | [H]/N=C1\CCN(C(C)=O)C2CC=CN=C12 |
| InChI | InChI=1S/C10H13N3O/c1-7(14)13-6-4-8(11)10-9(13)3-2-5-12-10/h2,5,9,11H,3-4,6H2,1H3/b11-8+ |
| InChIKey | CMJPEDBNMTXLKG-DHZHZOJOSA-N |
| XLogP | 0.99 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|