C22H27N3OS — CID 145256006
N-[(Z)-3,4-dihydro-2H-1-benzoxepin-5-ylidenemethyl]-4-[(3E)-hexa-1,3,5-trien-3-yl]piperazine-1-carbothioamide (PubChem CID 145256006) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is N-[(Z)-3,4-dihydro-2H-1-benzoxepin-5-ylidenemethyl]-4-[(3E)-hexa-1,3,5-trien-3-yl]piperazine-1-carbothioamide.
| Compound Name | N-[(Z)-3,4-dihydro-2H-1-benzoxepin-5-ylidenemethyl]-4-[(3E)-hexa-1,3,5-trien-3-yl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 145256006 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N-[(Z)-3,4-dihydro-2H-1-benzoxepin-5-ylidenemethyl]-4-[(3E)-hexa-1,3,5-trien-3-yl]piperazine-1-carbothioamide |
| SMILES | C=C/C=C(\C=C)N1CCN(C(=S)N/C=C2/CCCOc3ccccc32)CC1 |
| InChI | InChI=1S/C22H27N3OS/c1-3-8-19(4-2)24-12-14-25(15-13-24)22(27)23-17-18-9-7-16-26-21-11-6-5-10-20(18)21/h3-6,8,10-11,17H,1-2,7,9,12-16H2,(H,23,27)/b18-17-,19-8+ |
| InChIKey | OETGZJVZPKEURE-MGBZWLPISA-N |
| XLogP | 3.95 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|