About 3,4-diethylpiperazine-1-carbothiohydrazide;ethane
3,4-diethylpiperazine-1-carbothiohydrazide;ethane (PubChem CID 145256013) has the molecular formula C11H26N4S
and a molecular weight of 246.42 g/mol. Its IUPAC name is 3,4-diethylpiperazine-1-carbothiohydrazide;ethane.
Molecular Properties
| Compound Name | 3,4-diethylpiperazine-1-carbothiohydrazide;ethane |
| PubChem CID | 145256013 |
| Molecular Formula | C11H26N4S |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | 3,4-diethylpiperazine-1-carbothiohydrazide;ethane |
| SMILES | CC.CCC1CN(C(=S)NN)CCN1CC |
| InChI | InChI=1S/C9H20N4S.C2H6/c1-3-8-7-13(9(14)11-10)6-5-12(8)4-2;1-2/h8H,3-7,10H2,1-2H3,(H,11,14);1-2H3 |
| InChIKey | ISOUGZWNAWJKMB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diethylpiperazine-1-carbothiohydrazide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethylpiperazine-1-carbothiohydrazide;ethane?
The IUPAC name of 3,4-diethylpiperazine-1-carbothiohydrazide;ethane (CID 145256013) is 3,4-diethylpiperazine-1-carbothiohydrazide;ethane.
What is the SMILES notation for 3,4-diethylpiperazine-1-carbothiohydrazide;ethane?
The canonical SMILES for 3,4-diethylpiperazine-1-carbothiohydrazide;ethane is CC.CCC1CN(C(=S)NN)CCN1CC.
What is the InChIKey of 3,4-diethylpiperazine-1-carbothiohydrazide;ethane?
The InChIKey is ISOUGZWNAWJKMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N4S.C2H6/c1-3-8-7-13(9(14)11-10)6-5-12(8)4-2;1-2/h8H,3-7,10H2,1-2H3,(H,11,14);1-2H3.
What are the key properties of 3,4-diethylpiperazine-1-carbothiohydrazide;ethane?
3,4-diethylpiperazine-1-carbothiohydrazide;ethane has a molecular weight of 246.42 g/mol, XLogP of 1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethylpiperazine-1-carbothiohydrazide;ethane is sourced from PubChem (CID 145256013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).