C19H23N5OS — CID 145256073
N'-(3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-yl)-4-phenylpiperazine-1-carbothiohydrazide (PubChem CID 145256073) has the molecular formula C19H23N5OS and a molecular weight of 369.49 g/mol. Its IUPAC name is N'-(3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-yl)-4-phenylpiperazine-1-carbothiohydrazide.
| Compound Name | N'-(3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-yl)-4-phenylpiperazine-1-carbothiohydrazide |
|---|---|
| PubChem CID | 145256073 |
| Molecular Formula | C19H23N5OS |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | N'-(3,4-dihydro-2H-pyrano[3,2-b]pyridin-4-yl)-4-phenylpiperazine-1-carbothiohydrazide |
| SMILES | S=C(NNC1CCOc2cccnc21)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H23N5OS/c26-19(22-21-16-8-14-25-17-7-4-9-20-18(16)17)24-12-10-23(11-13-24)15-5-2-1-3-6-15/h1-7,9,16,21H,8,10-14H2,(H,22,26) |
| InChIKey | SADDPDYEFQDQFZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|