C14H19N3 — CID 145256104
6-ethenyl-1,4-dimethyl-3,5-dimethylidene-7-[(Z)-prop-1-enyl]-1,4-diazepin-2-imine (PubChem CID 145256104) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 6-ethenyl-1,4-dimethyl-3,5-dimethylidene-7-[(Z)-prop-1-enyl]-1,4-diazepin-2-imine.
| Compound Name | 6-ethenyl-1,4-dimethyl-3,5-dimethylidene-7-[(Z)-prop-1-enyl]-1,4-diazepin-2-imine |
|---|---|
| PubChem CID | 145256104 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 6-ethenyl-1,4-dimethyl-3,5-dimethylidene-7-[(Z)-prop-1-enyl]-1,4-diazepin-2-imine |
| SMILES | [H]/N=C1\C(=C)N(C)C(=C)C(C=C)=C(/C=C\C)N1C |
| InChI | InChI=1S/C14H19N3/c1-7-9-13-12(8-2)10(3)16(5)11(4)14(15)17(13)6/h7-9,15H,2-4H2,1,5-6H3/b9-7-,15-14+ |
| InChIKey | PGZBXGDMLGYTDL-DKWVFZHTSA-N |
| XLogP | 2.88 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|