C23H36N4O4 — CID 145256174
8-amino-N-[2-[[(5-formamido-5-oxopentan-2-yl)-formylamino]methyl]-3-methylphenyl]octanamide (PubChem CID 145256174) has the molecular formula C23H36N4O4 and a molecular weight of 432.57 g/mol. Its IUPAC name is 8-amino-N-[2-[[(5-formamido-5-oxopentan-2-yl)-formylamino]methyl]-3-methylphenyl]octanamide.
| Compound Name | 8-amino-N-[2-[[(5-formamido-5-oxopentan-2-yl)-formylamino]methyl]-3-methylphenyl]octanamide |
|---|---|
| PubChem CID | 145256174 |
| Molecular Formula | C23H36N4O4 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | 8-amino-N-[2-[[(5-formamido-5-oxopentan-2-yl)-formylamino]methyl]-3-methylphenyl]octanamide |
| SMILES | Cc1cccc(NC(=O)CCCCCCCN)c1CN(C=O)C(C)CCC(=O)NC=O |
| InChI | InChI=1S/C23H36N4O4/c1-18-9-8-10-21(26-23(31)11-6-4-3-5-7-14-24)20(18)15-27(17-29)19(2)12-13-22(30)25-16-28/h8-10,16-17,19H,3-7,11-15,24H2,1-2H3,(H,26,31)(H,25,28,30) |
| InChIKey | GJUZXGAOSZNLIC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|