C16H24ClNO2 — CID 145256294
N-[(3E,5E)-5-chloro-4-(cyclobutyloxymethyl)-2-methylhepta-1,3,5-trien-3-yl]propanamide (PubChem CID 145256294) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is N-[(3E,5E)-5-chloro-4-(cyclobutyloxymethyl)-2-methylhepta-1,3,5-trien-3-yl]propanamide.
| Compound Name | N-[(3E,5E)-5-chloro-4-(cyclobutyloxymethyl)-2-methylhepta-1,3,5-trien-3-yl]propanamide |
|---|---|
| PubChem CID | 145256294 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[(3E,5E)-5-chloro-4-(cyclobutyloxymethyl)-2-methylhepta-1,3,5-trien-3-yl]propanamide |
| SMILES | C=C(C)/C(NC(=O)CC)=C(COC1CCC1)\C(Cl)=C/C |
| InChI | InChI=1S/C16H24ClNO2/c1-5-14(17)13(10-20-12-8-7-9-12)16(11(3)4)18-15(19)6-2/h5,12H,3,6-10H2,1-2,4H3,(H,18,19)/b14-5+,16-13+ |
| InChIKey | VLPYRKSZCFRKMF-HOXIUOLLSA-N |
| XLogP | 4.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|