C12H18BrF3N2O — CID 145256340
4-bromo-2-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzene-1,2-diamine;ethane (PubChem CID 145256340) has the molecular formula C12H18BrF3N2O and a molecular weight of 343.19 g/mol. Its IUPAC name is 4-bromo-2-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzene-1,2-diamine;ethane.
| Compound Name | 4-bromo-2-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzene-1,2-diamine;ethane |
|---|---|
| PubChem CID | 145256340 |
| Molecular Formula | C12H18BrF3N2O |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | 4-bromo-2-N-[2-(2,2,2-trifluoroethoxy)ethyl]benzene-1,2-diamine;ethane |
| SMILES | CC.Nc1ccc(Br)cc1NCCOCC(F)(F)F |
| InChI | InChI=1S/C10H12BrF3N2O.C2H6/c11-7-1-2-8(15)9(5-7)16-3-4-17-6-10(12,13)14;1-2/h1-2,5,16H,3-4,6,15H2;1-2H3 |
| InChIKey | CWYHJQVYPXDWMT-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|