C13H18N4OS — CID 145256416
4-N-(4-methoxycyclohexyl)thieno[3,2-d]pyrimidine-2,4-diamine (PubChem CID 145256416) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 4-N-(4-methoxycyclohexyl)thieno[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-(4-methoxycyclohexyl)thieno[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 145256416 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 4-N-(4-methoxycyclohexyl)thieno[3,2-d]pyrimidine-2,4-diamine |
| SMILES | COC1CCC(Nc2nc(N)nc3ccsc23)CC1 |
| InChI | InChI=1S/C13H18N4OS/c1-18-9-4-2-8(3-5-9)15-12-11-10(6-7-19-11)16-13(14)17-12/h6-9H,2-5H2,1H3,(H3,14,15,16,17) |
| InChIKey | BRXYNYHFILZAJB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |