About 1-bromo-3-(4-bromocyclohexa-1,5-dien-1-yl)benzene
1-bromo-3-(4-bromocyclohexa-1,5-dien-1-yl)benzene (PubChem CID 145256452) has the molecular formula C12H10Br2
and a molecular weight of 314.02 g/mol. Its IUPAC name is 1-bromo-3-(4-bromocyclohexa-1,5-dien-1-yl)benzene.
Molecular Properties
| Compound Name | 1-bromo-3-(4-bromocyclohexa-1,5-dien-1-yl)benzene |
| PubChem CID | 145256452 |
| Molecular Formula | C12H10Br2 |
| Molecular Weight | 314.02 g/mol |
| Exact Mass | 311.91 |
| IUPAC Name | 1-bromo-3-(4-bromocyclohexa-1,5-dien-1-yl)benzene |
| SMILES | Brc1cccc(C2=CCC(Br)C=C2)c1 |
| InChI | InChI=1S/C12H10Br2/c13-11-6-4-9(5-7-11)10-2-1-3-12(14)8-10/h1-6,8,11H,7H2 |
| InChIKey | NVPNQBWZSKGIRQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.02 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3-(4-bromocyclohexa-1,5-dien-1-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-(4-bromocyclohexa-1,5-dien-1-yl)benzene?
The IUPAC name of 1-bromo-3-(4-bromocyclohexa-1,5-dien-1-yl)benzene (CID 145256452) is 1-bromo-3-(4-bromocyclohexa-1,5-dien-1-yl)benzene.
What is the SMILES notation for 1-bromo-3-(4-bromocyclohexa-1,5-dien-1-yl)benzene?
The canonical SMILES for 1-bromo-3-(4-bromocyclohexa-1,5-dien-1-yl)benzene is Brc1cccc(C2=CCC(Br)C=C2)c1.
What is the InChIKey of 1-bromo-3-(4-bromocyclohexa-1,5-dien-1-yl)benzene?
The InChIKey is NVPNQBWZSKGIRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Br2/c13-11-6-4-9(5-7-11)10-2-1-3-12(14)8-10/h1-6,8,11H,7H2.
What are the key properties of 1-bromo-3-(4-bromocyclohexa-1,5-dien-1-yl)benzene?
1-bromo-3-(4-bromocyclohexa-1,5-dien-1-yl)benzene has a molecular weight of 314.02 g/mol, XLogP of 4.56, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-(4-bromocyclohexa-1,5-dien-1-yl)benzene is sourced from PubChem (CID 145256452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).