C47H44BNOS — CID 145257254
[4-dibenzothiophen-4-yl-3-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)phenyl]-methyl-(2,3,3-trimethylbutan-2-yloxy)borane (PubChem CID 145257254) has the molecular formula C47H44BNOS and a molecular weight of 681.75 g/mol. Its IUPAC name is [4-dibenzothiophen-4-yl-3-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)phenyl]-methyl-(2,3,3-trimethylbutan-2-yloxy)borane.
| Compound Name | [4-dibenzothiophen-4-yl-3-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)phenyl]-methyl-(2,3,3-trimethylbutan-2-yloxy)borane |
|---|---|
| PubChem CID | 145257254 |
| Molecular Formula | C47H44BNOS |
| Molecular Weight | 681.75 g/mol |
| Exact Mass | 681.32 |
| IUPAC Name | [4-dibenzothiophen-4-yl-3-(7,7-dimethylindeno[2,1-b]carbazol-5-yl)phenyl]-methyl-(2,3,3-trimethylbutan-2-yloxy)borane |
| SMILES | CB(OC(C)(C)C(C)(C)C)c1ccc(-c2cccc3c2sc2ccccc23)c(-n2c3ccccc3c3cc4c(cc32)C(C)(C)c2ccccc2-4)c1 |
| InChI | InChI=1S/C47H44BNOS/c1-45(2,3)47(6,7)50-48(8)29-24-25-32(34-19-15-20-35-33-18-11-14-23-43(33)51-44(34)35)41(26-29)49-40-22-13-10-17-31(40)37-27-36-30-16-9-12-21-38(30)46(4,5)39(36)28-42(37)49/h9-28H,1-8H3 |
| InChIKey | QEVLTMVYJSAYJV-UHFFFAOYSA-N |
| XLogP | 12.79 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.75 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|