C36H41F2N3O5 — CID 145257952
methyl 2-[(22S)-17,18-difluoro-4,5,8,22,28-pentamethyl-21,24,27-trioxa-1,7,34-triazahexacyclo[26.2.2.16,9.110,14.02,7.015,20]tetratriaconta-2,4,6(34),8,10,12,14(33),15,17,19-decaen-3-yl]acetate (PubChem CID 145257952) has the molecular formula C36H41F2N3O5 and a molecular weight of 633.74 g/mol. Its IUPAC name is methyl 2-[(22S)-17,18-difluoro-4,5,8,22,28-pentamethyl-21,24,27-trioxa-1,7,34-triazahexacyclo[26.2.2.16,9.110,14.02,7.015,20]tetratriaconta-2,4,6(34),8,10,12,14(33),15,17,19-decaen-3-yl]acetate.
| Compound Name | methyl 2-[(22S)-17,18-difluoro-4,5,8,22,28-pentamethyl-21,24,27-trioxa-1,7,34-triazahexacyclo[26.2.2.16,9.110,14.02,7.015,20]tetratriaconta-2,4,6(34),8,10,12,14(33),15,17,19-decaen-3-yl]acetate |
|---|---|
| PubChem CID | 145257952 |
| Molecular Formula | C36H41F2N3O5 |
| Molecular Weight | 633.74 g/mol |
| Exact Mass | 633.30 |
| IUPAC Name | methyl 2-[(22S)-17,18-difluoro-4,5,8,22,28-pentamethyl-21,24,27-trioxa-1,7,34-triazahexacyclo[26.2.2.16,9.110,14.02,7.015,20]tetratriaconta-2,4,6(34),8,10,12,14(33),15,17,19-decaen-3-yl]acetate |
| SMILES | COC(=O)Cc1c(C)c(C)c2nc3c(C)n2c1N1CCC(C)(CC1)OCCOC[C@H](C)Oc1cc(F)c(F)cc1-c1cccc-3c1 |
| InChI | InChI=1S/C36H41F2N3O5/c1-21-20-44-14-15-45-36(5)10-12-40(13-11-36)35-27(18-32(42)43-6)22(2)23(3)34-39-33(24(4)41(34)35)26-9-7-8-25(16-26)28-17-29(37)30(38)19-31(28)46-21/h7-9,16-17,19,21H,10-15,18,20H2,1-6H3/t21-/m0/s1 |
| InChIKey | IURMSZPZMRRJCY-NRFANRHFSA-N |
| XLogP | 6.76 |
| TPSA | 74.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.74 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|