C55H63N3O2 — CID 145258417
[2-[[4-[bis[4-(N,2,4,6-tetramethylanilino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylidenepentanoate (PubChem CID 145258417) has the molecular formula C55H63N3O2 and a molecular weight of 798.13 g/mol. Its IUPAC name is [2-[[4-[bis[4-(N,2,4,6-tetramethylanilino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylidenepentanoate.
| Compound Name | [2-[[4-[bis[4-(N,2,4,6-tetramethylanilino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylidenepentanoate |
|---|---|
| PubChem CID | 145258417 |
| Molecular Formula | C55H63N3O2 |
| Molecular Weight | 798.13 g/mol |
| Exact Mass | 797.49 |
| IUPAC Name | [2-[[4-[bis[4-(N,2,4,6-tetramethylanilino)phenyl]methyl]naphthalen-1-yl]amino]cyclohexyl] 2-methylidenepentanoate |
| SMILES | C=C(CCC)C(=O)OC1CCCCC1Nc1ccc(C(c2ccc(N(C)c3c(C)cc(C)cc3C)cc2)c2ccc(N(C)c3c(C)cc(C)cc3C)cc2)c2ccccc12 |
| InChI | InChI=1S/C55H63N3O2/c1-11-16-37(4)55(59)60-51-20-15-14-19-50(51)56-49-30-29-48(46-17-12-13-18-47(46)49)52(42-21-25-44(26-22-42)57(9)53-38(5)31-35(2)32-39(53)6)43-23-27-45(28-24-43)58(10)54-40(7)33-36(3)34-41(54)8/h12-13,17-18,21-34,50-52,56H,4,11,14-16,19-20H2,1-3,5-10H3 |
| InChIKey | XUQIXQRAGUOYBW-UHFFFAOYSA-N |
| XLogP | 14.03 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.13 |
| LogP ≤ 5 | 14.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|