About N-[1-(1,3-dioxo-1,2-thiazol-5-yl)pyrazol-4-yl]propane-2-sulfonamide
N-[1-(1,3-dioxo-1,2-thiazol-5-yl)pyrazol-4-yl]propane-2-sulfonamide (PubChem CID 145258467) has the molecular formula C9H12N4O4S2
and a molecular weight of 304.35 g/mol. Its IUPAC name is N-[1-(1,3-dioxo-1,2-thiazol-5-yl)pyrazol-4-yl]propane-2-sulfonamide.
Molecular Properties
| Compound Name | N-[1-(1,3-dioxo-1,2-thiazol-5-yl)pyrazol-4-yl]propane-2-sulfonamide |
| PubChem CID | 145258467 |
| Molecular Formula | C9H12N4O4S2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | N-[1-(1,3-dioxo-1,2-thiazol-5-yl)pyrazol-4-yl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)Nc1cnn(C2=CC(=O)NS2=O)c1 |
| InChI | InChI=1S/C9H12N4O4S2/c1-6(2)19(16,17)12-7-4-10-13(5-7)9-3-8(14)11-18(9)15/h3-6,12H,1-2H3,(H,11,14) |
| InChIKey | PLEPXPITFHVDRM-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[1-(1,3-dioxo-1,2-thiazol-5-yl)pyrazol-4-yl]propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(1,3-dioxo-1,2-thiazol-5-yl)pyrazol-4-yl]propane-2-sulfonamide?
The IUPAC name of N-[1-(1,3-dioxo-1,2-thiazol-5-yl)pyrazol-4-yl]propane-2-sulfonamide (CID 145258467) is N-[1-(1,3-dioxo-1,2-thiazol-5-yl)pyrazol-4-yl]propane-2-sulfonamide.
What is the SMILES notation for N-[1-(1,3-dioxo-1,2-thiazol-5-yl)pyrazol-4-yl]propane-2-sulfonamide?
The canonical SMILES for N-[1-(1,3-dioxo-1,2-thiazol-5-yl)pyrazol-4-yl]propane-2-sulfonamide is CC(C)S(=O)(=O)Nc1cnn(C2=CC(=O)NS2=O)c1.
What is the InChIKey of N-[1-(1,3-dioxo-1,2-thiazol-5-yl)pyrazol-4-yl]propane-2-sulfonamide?
The InChIKey is PLEPXPITFHVDRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4O4S2/c1-6(2)19(16,17)12-7-4-10-13(5-7)9-3-8(14)11-18(9)15/h3-6,12H,1-2H3,(H,11,14).
What are the key properties of N-[1-(1,3-dioxo-1,2-thiazol-5-yl)pyrazol-4-yl]propane-2-sulfonamide?
N-[1-(1,3-dioxo-1,2-thiazol-5-yl)pyrazol-4-yl]propane-2-sulfonamide has a molecular weight of 304.35 g/mol, XLogP of -0.37, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(1,3-dioxo-1,2-thiazol-5-yl)pyrazol-4-yl]propane-2-sulfonamide is sourced from PubChem (CID 145258467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).