C42H28N4O — CID 145258710
N-[(30-oxa-3-azaheptacyclo[15.13.0.02,10.04,9.011,16.018,23.024,29]triaconta-1(17),2(10),4,6,8,11,13,15,18,20,22,24,26,28-tetradecaen-3-ylamino)-phenylmethylidene]benzenecarboximidamide (PubChem CID 145258710) has the molecular formula C42H28N4O and a molecular weight of 604.71 g/mol. Its IUPAC name is N-[(30-oxa-3-azaheptacyclo[15.13.0.02,10.04,9.011,16.018,23.024,29]triaconta-1(17),2(10),4,6,8,11,13,15,18,20,22,24,26,28-tetradecaen-3-ylamino)-phenylmethylidene]benzenecarboximidamide.
| Compound Name | N-[(30-oxa-3-azaheptacyclo[15.13.0.02,10.04,9.011,16.018,23.024,29]triaconta-1(17),2(10),4,6,8,11,13,15,18,20,22,24,26,28-tetradecaen-3-ylamino)-phenylmethylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 145258710 |
| Molecular Formula | C42H28N4O |
| Molecular Weight | 604.71 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | N-[(30-oxa-3-azaheptacyclo[15.13.0.02,10.04,9.011,16.018,23.024,29]triaconta-1(17),2(10),4,6,8,11,13,15,18,20,22,24,26,28-tetradecaen-3-ylamino)-phenylmethylidene]benzenecarboximidamide |
| SMILES | [H]/N=C(/N=C(/Nn1c2ccccc2c2c3ccccc3c3c(c21)Oc1ccccc1-c1ccccc1-3)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H28N4O/c43-41(27-15-3-1-4-16-27)44-42(28-17-5-2-6-18-28)45-46-35-25-13-11-24-34(35)37-32-22-9-10-23-33(32)38-31-21-8-7-19-29(31)30-20-12-14-26-36(30)47-40(38)39(37)46/h1-26H,(H2,43,44,45) |
| InChIKey | UWLAPXYPTCMJQF-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.71 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|