About 5-fluoro-6-methyl-4-methylidene-1H-imidazo[4,5-c]pyridine
5-fluoro-6-methyl-4-methylidene-1H-imidazo[4,5-c]pyridine (PubChem CID 145259416) has the molecular formula C8H8FN3
and a molecular weight of 165.17 g/mol. Its IUPAC name is 5-fluoro-6-methyl-4-methylidene-1H-imidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 5-fluoro-6-methyl-4-methylidene-1H-imidazo[4,5-c]pyridine |
| PubChem CID | 145259416 |
| Molecular Formula | C8H8FN3 |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | 5-fluoro-6-methyl-4-methylidene-1H-imidazo[4,5-c]pyridine |
| SMILES | C=C1c2nc[nH]c2C=C(C)N1F |
| InChI | InChI=1S/C8H8FN3/c1-5-3-7-8(11-4-10-7)6(2)12(5)9/h3-4H,2H2,1H3,(H,10,11) |
| InChIKey | VHMLNTNQQDPONV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-6-methyl-4-methylidene-1H-imidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-6-methyl-4-methylidene-1H-imidazo[4,5-c]pyridine?
The IUPAC name of 5-fluoro-6-methyl-4-methylidene-1H-imidazo[4,5-c]pyridine (CID 145259416) is 5-fluoro-6-methyl-4-methylidene-1H-imidazo[4,5-c]pyridine.
What is the SMILES notation for 5-fluoro-6-methyl-4-methylidene-1H-imidazo[4,5-c]pyridine?
The canonical SMILES for 5-fluoro-6-methyl-4-methylidene-1H-imidazo[4,5-c]pyridine is C=C1c2nc[nH]c2C=C(C)N1F.
What is the InChIKey of 5-fluoro-6-methyl-4-methylidene-1H-imidazo[4,5-c]pyridine?
The InChIKey is VHMLNTNQQDPONV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8FN3/c1-5-3-7-8(11-4-10-7)6(2)12(5)9/h3-4H,2H2,1H3,(H,10,11).
What are the key properties of 5-fluoro-6-methyl-4-methylidene-1H-imidazo[4,5-c]pyridine?
5-fluoro-6-methyl-4-methylidene-1H-imidazo[4,5-c]pyridine has a molecular weight of 165.17 g/mol, XLogP of 1.94, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-6-methyl-4-methylidene-1H-imidazo[4,5-c]pyridine is sourced from PubChem (CID 145259416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).