About ethane;2-ethoxypropane;N-ethyl-1-(5-methyl-3,4-dihydropyridin-6-yl)ethanimine
ethane;2-ethoxypropane;N-ethyl-1-(5-methyl-3,4-dihydropyridin-6-yl)ethanimine (PubChem CID 145259417) has the molecular formula C17H34N2O
and a molecular weight of 282.47 g/mol. Its IUPAC name is ethane;2-ethoxypropane;N-ethyl-1-(5-methyl-3,4-dihydropyridin-6-yl)ethanimine.
Molecular Properties
| Compound Name | ethane;2-ethoxypropane;N-ethyl-1-(5-methyl-3,4-dihydropyridin-6-yl)ethanimine |
| PubChem CID | 145259417 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | ethane;2-ethoxypropane;N-ethyl-1-(5-methyl-3,4-dihydropyridin-6-yl)ethanimine |
| SMILES | CC.CC/N=C(\C)C1=C(C)CCC=N1.CCOC(C)C |
| InChI | InChI=1S/C10H16N2.C5H12O.C2H6/c1-4-11-9(3)10-8(2)6-5-7-12-10;1-4-6-5(2)3;1-2/h7H,4-6H2,1-3H3;5H,4H2,1-3H3;1-2H3/b11-9+;; |
| InChIKey | LMOIMIHLPKZRMV-OTBYXNOXSA-N |
| XLogP | 5.06 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-ethoxypropane;N-ethyl-1-(5-methyl-3,4-dihydropyridin-6-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethoxypropane;N-ethyl-1-(5-methyl-3,4-dihydropyridin-6-yl)ethanimine?
The IUPAC name of ethane;2-ethoxypropane;N-ethyl-1-(5-methyl-3,4-dihydropyridin-6-yl)ethanimine (CID 145259417) is ethane;2-ethoxypropane;N-ethyl-1-(5-methyl-3,4-dihydropyridin-6-yl)ethanimine.
What is the SMILES notation for ethane;2-ethoxypropane;N-ethyl-1-(5-methyl-3,4-dihydropyridin-6-yl)ethanimine?
The canonical SMILES for ethane;2-ethoxypropane;N-ethyl-1-(5-methyl-3,4-dihydropyridin-6-yl)ethanimine is CC.CC/N=C(\C)C1=C(C)CCC=N1.CCOC(C)C.
What is the InChIKey of ethane;2-ethoxypropane;N-ethyl-1-(5-methyl-3,4-dihydropyridin-6-yl)ethanimine?
The InChIKey is LMOIMIHLPKZRMV-OTBYXNOXSA-N. The full InChI is InChI=1S/C10H16N2.C5H12O.C2H6/c1-4-11-9(3)10-8(2)6-5-7-12-10;1-4-6-5(2)3;1-2/h7H,4-6H2,1-3H3;5H,4H2,1-3H3;1-2H3/b11-9+;;.
What are the key properties of ethane;2-ethoxypropane;N-ethyl-1-(5-methyl-3,4-dihydropyridin-6-yl)ethanimine?
ethane;2-ethoxypropane;N-ethyl-1-(5-methyl-3,4-dihydropyridin-6-yl)ethanimine has a molecular weight of 282.47 g/mol, XLogP of 5.06, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethoxypropane;N-ethyl-1-(5-methyl-3,4-dihydropyridin-6-yl)ethanimine is sourced from PubChem (CID 145259417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).