C32H52N8O6 — CID 145259431
N-[(E)-1-aminobut-1-enyl]-3-methyl-2-(2-methylpropylideneamino)but-2-enamide;[5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methyl nitrite;3-(5-methyloxolan-2-yl)propan-1-ol (PubChem CID 145259431) has the molecular formula C32H52N8O6 and a molecular weight of 644.82 g/mol. Its IUPAC name is N-[(E)-1-aminobut-1-enyl]-3-methyl-2-(2-methylpropylideneamino)but-2-enamide;[5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methyl nitrite;3-(5-methyloxolan-2-yl)propan-1-ol.
| Compound Name | N-[(E)-1-aminobut-1-enyl]-3-methyl-2-(2-methylpropylideneamino)but-2-enamide;[5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methyl nitrite;3-(5-methyloxolan-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 145259431 |
| Molecular Formula | C32H52N8O6 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.40 |
| IUPAC Name | N-[(E)-1-aminobut-1-enyl]-3-methyl-2-(2-methylpropylideneamino)but-2-enamide;[5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methyl nitrite;3-(5-methyloxolan-2-yl)propan-1-ol |
| SMILES | CC/C=C(\N)NC(=O)C(/N=C/C(C)C)=C(C)C.CC1CCC(CCCO)O1.Nc1ncnc2c1ccn2C1CCC(CON=O)O1 |
| InChI | InChI=1S/C13H23N3O.C11H13N5O3.C8H16O2/c1-6-7-11(14)16-13(17)12(10(4)5)15-8-9(2)3;12-10-8-3-4-16(11(8)14-6-13-10)9-2-1-7(19-9)5-18-15-17;1-7-4-5-8(10-7)3-2-6-9/h7-9H,6,14H2,1-5H3,(H,16,17);3-4,6-7,9H,1-2,5H2,(H2,12,13,14);7-9H,2-6H2,1H3/b11-7+,15-8+;; |
| InChIKey | SSBVOATYKDJKKC-FTAOZAGPSA-N |
| XLogP | 5.05 |
| TPSA | 201.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|