C15H25N3O3 — CID 145259972
tert-butyl N-[2-(benzylamino)-2-oxoethyl]carbamate;methanamine (PubChem CID 145259972) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is tert-butyl N-[2-(benzylamino)-2-oxoethyl]carbamate;methanamine.
| Compound Name | tert-butyl N-[2-(benzylamino)-2-oxoethyl]carbamate;methanamine |
|---|---|
| PubChem CID | 145259972 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | tert-butyl N-[2-(benzylamino)-2-oxoethyl]carbamate;methanamine |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCc1ccccc1.CN |
| InChI | InChI=1S/C14H20N2O3.CH5N/c1-14(2,3)19-13(18)16-10-12(17)15-9-11-7-5-4-6-8-11;1-2/h4-8H,9-10H2,1-3H3,(H,15,17)(H,16,18);2H2,1H3 |
| InChIKey | KDETXZWOQJDFOJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |