About (2Z,5E)-4-imino-5-methanimidoyl-2-methylhepta-2,5-dienamide
(2Z,5E)-4-imino-5-methanimidoyl-2-methylhepta-2,5-dienamide (PubChem CID 145260236) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is (2Z,5E)-4-imino-5-methanimidoyl-2-methylhepta-2,5-dienamide.
Molecular Properties
| Compound Name | (2Z,5E)-4-imino-5-methanimidoyl-2-methylhepta-2,5-dienamide |
| PubChem CID | 145260236 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (2Z,5E)-4-imino-5-methanimidoyl-2-methylhepta-2,5-dienamide |
| SMILES | [H]/N=C(/C=C(/C)C(N)=O)C(/C=N/[H])=C\C |
| InChI | InChI=1S/C9H13N3O/c1-3-7(5-10)8(11)4-6(2)9(12)13/h3-5,10-11H,1-2H3,(H2,12,13)/b6-4-,7-3+,10-5+,11-8- |
| InChIKey | CEHJRBXTDUFMEF-HCGUGFOSSA-N |
| XLogP | 1.03 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z,5E)-4-imino-5-methanimidoyl-2-methylhepta-2,5-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,5E)-4-imino-5-methanimidoyl-2-methylhepta-2,5-dienamide?
The IUPAC name of (2Z,5E)-4-imino-5-methanimidoyl-2-methylhepta-2,5-dienamide (CID 145260236) is (2Z,5E)-4-imino-5-methanimidoyl-2-methylhepta-2,5-dienamide.
What is the SMILES notation for (2Z,5E)-4-imino-5-methanimidoyl-2-methylhepta-2,5-dienamide?
The canonical SMILES for (2Z,5E)-4-imino-5-methanimidoyl-2-methylhepta-2,5-dienamide is [H]/N=C(/C=C(/C)C(N)=O)C(/C=N/[H])=C\C.
What is the InChIKey of (2Z,5E)-4-imino-5-methanimidoyl-2-methylhepta-2,5-dienamide?
The InChIKey is CEHJRBXTDUFMEF-HCGUGFOSSA-N. The full InChI is InChI=1S/C9H13N3O/c1-3-7(5-10)8(11)4-6(2)9(12)13/h3-5,10-11H,1-2H3,(H2,12,13)/b6-4-,7-3+,10-5+,11-8-.
What are the key properties of (2Z,5E)-4-imino-5-methanimidoyl-2-methylhepta-2,5-dienamide?
(2Z,5E)-4-imino-5-methanimidoyl-2-methylhepta-2,5-dienamide has a molecular weight of 179.22 g/mol, XLogP of 1.03, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,5E)-4-imino-5-methanimidoyl-2-methylhepta-2,5-dienamide is sourced from PubChem (CID 145260236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).