C17H14ClFN4O — CID 145260289
6-(6-amino-2-fluoro-3-pyridinyl)-2-[(4-chlorophenyl)methyl]-4-methylpyridazin-3-one (PubChem CID 145260289) has the molecular formula C17H14ClFN4O and a molecular weight of 344.78 g/mol. Its IUPAC name is 6-(6-amino-2-fluoro-3-pyridinyl)-2-[(4-chlorophenyl)methyl]-4-methylpyridazin-3-one.
| Compound Name | 6-(6-amino-2-fluoro-3-pyridinyl)-2-[(4-chlorophenyl)methyl]-4-methylpyridazin-3-one |
|---|---|
| PubChem CID | 145260289 |
| Molecular Formula | C17H14ClFN4O |
| Molecular Weight | 344.78 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 6-(6-amino-2-fluoro-3-pyridinyl)-2-[(4-chlorophenyl)methyl]-4-methylpyridazin-3-one |
| SMILES | Cc1cc(-c2ccc(N)nc2F)nn(Cc2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C17H14ClFN4O/c1-10-8-14(13-6-7-15(20)21-16(13)19)22-23(17(10)24)9-11-2-4-12(18)5-3-11/h2-8H,9H2,1H3,(H2,20,21) |
| InChIKey | KQVUCSPWNYVZNC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.78 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|