About 2-bromobenzenethiol;1,2,4-trimethylbenzene
2-bromobenzenethiol;1,2,4-trimethylbenzene (PubChem CID 145260603) has the molecular formula C15H17BrS
and a molecular weight of 309.27 g/mol. Its IUPAC name is 2-bromobenzenethiol;1,2,4-trimethylbenzene.
Molecular Properties
| Compound Name | 2-bromobenzenethiol;1,2,4-trimethylbenzene |
| PubChem CID | 145260603 |
| Molecular Formula | C15H17BrS |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 2-bromobenzenethiol;1,2,4-trimethylbenzene |
| SMILES | Cc1ccc(C)c(C)c1.Sc1ccccc1Br |
| InChI | InChI=1S/C9H12.C6H5BrS/c1-7-4-5-8(2)9(3)6-7;7-5-3-1-2-4-6(5)8/h4-6H,1-3H3;1-4,8H |
| InChIKey | KPPLJDALAAKDNR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-bromobenzenethiol;1,2,4-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromobenzenethiol;1,2,4-trimethylbenzene?
The IUPAC name of 2-bromobenzenethiol;1,2,4-trimethylbenzene (CID 145260603) is 2-bromobenzenethiol;1,2,4-trimethylbenzene.
What is the SMILES notation for 2-bromobenzenethiol;1,2,4-trimethylbenzene?
The canonical SMILES for 2-bromobenzenethiol;1,2,4-trimethylbenzene is Cc1ccc(C)c(C)c1.Sc1ccccc1Br.
What is the InChIKey of 2-bromobenzenethiol;1,2,4-trimethylbenzene?
The InChIKey is KPPLJDALAAKDNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C6H5BrS/c1-7-4-5-8(2)9(3)6-7;7-5-3-1-2-4-6(5)8/h4-6H,1-3H3;1-4,8H.
What are the key properties of 2-bromobenzenethiol;1,2,4-trimethylbenzene?
2-bromobenzenethiol;1,2,4-trimethylbenzene has a molecular weight of 309.27 g/mol, XLogP of 5.35, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromobenzenethiol;1,2,4-trimethylbenzene is sourced from PubChem (CID 145260603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).