C28H30N6OS2 — CID 145260729
4-[12-[(1-ethylidene-1,4-thiazinan-4-yl)methyl]-4-(1H-indol-4-yl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl]morpholine (PubChem CID 145260729) has the molecular formula C28H30N6OS2 and a molecular weight of 530.72 g/mol. Its IUPAC name is 4-[12-[(1-ethylidene-1,4-thiazinan-4-yl)methyl]-4-(1H-indol-4-yl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl]morpholine.
| Compound Name | 4-[12-[(1-ethylidene-1,4-thiazinan-4-yl)methyl]-4-(1H-indol-4-yl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl]morpholine |
|---|---|
| PubChem CID | 145260729 |
| Molecular Formula | C28H30N6OS2 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 4-[12-[(1-ethylidene-1,4-thiazinan-4-yl)methyl]-4-(1H-indol-4-yl)-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-6-yl]morpholine |
| SMILES | CC=S1CCN(Cc2cnc3sc4c(N5CCOCC5)nc(-c5cccc6[nH]ccc56)nc4c3c2)CC1 |
| InChI | InChI=1S/C28H30N6OS2/c1-2-37-14-10-33(11-15-37)18-19-16-22-24-25(36-28(22)30-17-19)27(34-8-12-35-13-9-34)32-26(31-24)21-4-3-5-23-20(21)6-7-29-23/h2-7,16-17,29H,8-15,18H2,1H3 |
| InChIKey | JNWCKXAUHOJBKD-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|