2-[(Z)-4-ethoxybut-2-enoxy]ethanamine;molecular hydrogen

C8H19NO2 — CID 145261734

IUPAC2-[(Z)-4-ethoxybut-2-enoxy]ethanamine;molecular hydrogen
SMILESCCOC/C=C\COCCN.[H][H]
InChIInChI=1S/C8H17NO2.H2/c1-2-10-6-3-4-7-11-8-5-9;/h3-4H,2,5-9H2,1H3;1H/b4-3-;
InChIKeyALQBTNLEJAAVIJ-LNKPDPKZSA-N
MW161.25 g/mol
LogP0.80
Rot. Bonds7

About 2-[(Z)-4-ethoxybut-2-enoxy]ethanamine;molecular hydrogen

2-[(Z)-4-ethoxybut-2-enoxy]ethanamine;molecular hydrogen (PubChem CID 145261734) has the molecular formula C8H19NO2 and a molecular weight of 161.25 g/mol. Its IUPAC name is 2-[(Z)-4-ethoxybut-2-enoxy]ethanamine;molecular hydrogen.

Molecular Properties

Compound Name2-[(Z)-4-ethoxybut-2-enoxy]ethanamine;molecular hydrogen
PubChem CID145261734
Molecular FormulaC8H19NO2
Molecular Weight161.25 g/mol
Exact Mass161.14
IUPAC Name2-[(Z)-4-ethoxybut-2-enoxy]ethanamine;molecular hydrogen
SMILESCCOC/C=C\COCCN.[H][H]
InChIInChI=1S/C8H17NO2.H2/c1-2-10-6-3-4-7-11-8-5-9;/h3-4H,2,5-9H2,1H3;1H/b4-3-;
InChIKeyALQBTNLEJAAVIJ-LNKPDPKZSA-N
XLogP0.80
TPSA44.48 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500161.25
LogP ≤ 50.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-[(Z)-4-ethoxybut-2-enoxy]ethanamine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(Z)-4-ethoxybut-2-enoxy]ethanamine;molecular hydrogen?
The IUPAC name of 2-[(Z)-4-ethoxybut-2-enoxy]ethanamine;molecular hydrogen (CID 145261734) is 2-[(Z)-4-ethoxybut-2-enoxy]ethanamine;molecular hydrogen.
What is the SMILES notation for 2-[(Z)-4-ethoxybut-2-enoxy]ethanamine;molecular hydrogen?
The canonical SMILES for 2-[(Z)-4-ethoxybut-2-enoxy]ethanamine;molecular hydrogen is CCOC/C=C\COCCN.[H][H].
What is the InChIKey of 2-[(Z)-4-ethoxybut-2-enoxy]ethanamine;molecular hydrogen?
The InChIKey is ALQBTNLEJAAVIJ-LNKPDPKZSA-N. The full InChI is InChI=1S/C8H17NO2.H2/c1-2-10-6-3-4-7-11-8-5-9;/h3-4H,2,5-9H2,1H3;1H/b4-3-;.
What are the key properties of 2-[(Z)-4-ethoxybut-2-enoxy]ethanamine;molecular hydrogen?
2-[(Z)-4-ethoxybut-2-enoxy]ethanamine;molecular hydrogen has a molecular weight of 161.25 g/mol, XLogP of 0.80, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(Z)-4-ethoxybut-2-enoxy]ethanamine;molecular hydrogen is sourced from PubChem (CID 145261734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).