C15H22N2O — CID 145262182
5-cyclohexyl-1,2,3,4-tetrahydro-1,5-benzodiazepin-2-ol (PubChem CID 145262182) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 5-cyclohexyl-1,2,3,4-tetrahydro-1,5-benzodiazepin-2-ol.
| Compound Name | 5-cyclohexyl-1,2,3,4-tetrahydro-1,5-benzodiazepin-2-ol |
|---|---|
| PubChem CID | 145262182 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 5-cyclohexyl-1,2,3,4-tetrahydro-1,5-benzodiazepin-2-ol |
| SMILES | OC1CCN(C2CCCCC2)c2ccccc2N1 |
| InChI | InChI=1S/C15H22N2O/c18-15-10-11-17(12-6-2-1-3-7-12)14-9-5-4-8-13(14)16-15/h4-5,8-9,12,15-16,18H,1-3,6-7,10-11H2 |
| InChIKey | NWMQATDRWXMYQG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |