C15H16N6 — CID 145262493
6-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]pyrido[3,2-d]pyrimidine-2,4,6-triamine (PubChem CID 145262493) has the molecular formula C15H16N6 and a molecular weight of 280.34 g/mol. Its IUPAC name is 6-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]pyrido[3,2-d]pyrimidine-2,4,6-triamine.
| Compound Name | 6-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]pyrido[3,2-d]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 145262493 |
| Molecular Formula | C15H16N6 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 6-N-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]pyrido[3,2-d]pyrimidine-2,4,6-triamine |
| SMILES | C=C/C=C\C(=C/C=C)Nc1ccc2nc(N)nc(N)c2n1 |
| InChI | InChI=1S/C15H16N6/c1-3-5-7-10(6-4-2)18-12-9-8-11-13(20-12)14(16)21-15(17)19-11/h3-9H,1-2H2,(H,18,20)(H4,16,17,19,21)/b7-5-,10-6+ |
| InChIKey | XJVIWZQKJMEEKQ-ZPRNNRRZSA-N |
| XLogP | 2.41 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|