C42H39NO3 — CID 145263158
(2Z)-5',5'-dimethyl-2-[(2Z)-penta-2,4-dienylidene]spiro[1-benzofuran-3,2'-furan];5',5'-dimethyl-10-phenylspiro[acridine-9,2'-furan] (PubChem CID 145263158) has the molecular formula C42H39NO3 and a molecular weight of 605.78 g/mol. Its IUPAC name is (2Z)-5',5'-dimethyl-2-[(2Z)-penta-2,4-dienylidene]spiro[1-benzofuran-3,2'-furan];5',5'-dimethyl-10-phenylspiro[acridine-9,2'-furan].
| Compound Name | (2Z)-5',5'-dimethyl-2-[(2Z)-penta-2,4-dienylidene]spiro[1-benzofuran-3,2'-furan];5',5'-dimethyl-10-phenylspiro[acridine-9,2'-furan] |
|---|---|
| PubChem CID | 145263158 |
| Molecular Formula | C42H39NO3 |
| Molecular Weight | 605.78 g/mol |
| Exact Mass | 605.29 |
| IUPAC Name | (2Z)-5',5'-dimethyl-2-[(2Z)-penta-2,4-dienylidene]spiro[1-benzofuran-3,2'-furan];5',5'-dimethyl-10-phenylspiro[acridine-9,2'-furan] |
| SMILES | C=C/C=C\C=C1/Oc2ccccc2C12C=CC(C)(C)O2.CC1(C)C=CC2(O1)c1ccccc1N(c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C24H21NO.C18H18O2/c1-23(2)16-17-24(26-23)19-12-6-8-14-21(19)25(18-10-4-3-5-11-18)22-15-9-7-13-20(22)24;1-4-5-6-11-16-18(13-12-17(2,3)20-18)14-9-7-8-10-15(14)19-16/h3-17H,1-2H3;4-13H,1H2,2-3H3/b;6-5-,16-11- |
| InChIKey | NAXACEVVBIVAML-WHJBREQBSA-N |
| XLogP | 10.34 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.78 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|