About tert-butyl N-[2-(3-propoxybuta-1,3-dien-2-yloxy)ethyl]carbamate;molecular hydrogen
tert-butyl N-[2-(3-propoxybuta-1,3-dien-2-yloxy)ethyl]carbamate;molecular hydrogen (PubChem CID 145264017) has the molecular formula C14H27NO4
and a molecular weight of 273.37 g/mol. Its IUPAC name is tert-butyl N-[2-(3-propoxybuta-1,3-dien-2-yloxy)ethyl]carbamate;molecular hydrogen.
Molecular Properties
| Compound Name | tert-butyl N-[2-(3-propoxybuta-1,3-dien-2-yloxy)ethyl]carbamate;molecular hydrogen |
| PubChem CID | 145264017 |
| Molecular Formula | C14H27NO4 |
| Molecular Weight | 273.37 g/mol |
| Exact Mass | 273.19 |
| IUPAC Name | tert-butyl N-[2-(3-propoxybuta-1,3-dien-2-yloxy)ethyl]carbamate;molecular hydrogen |
| SMILES | C=C(OCCC)C(=C)OCCNC(=O)OC(C)(C)C.[H][H] |
| InChI | InChI=1S/C14H25NO4.H2/c1-7-9-17-11(2)12(3)18-10-8-15-13(16)19-14(4,5)6;/h2-3,7-10H2,1,4-6H3,(H,15,16);1H |
| InChIKey | OEZNWFYNRWHQIM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[2-(3-propoxybuta-1,3-dien-2-yloxy)ethyl]carbamate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-(3-propoxybuta-1,3-dien-2-yloxy)ethyl]carbamate;molecular hydrogen?
The IUPAC name of tert-butyl N-[2-(3-propoxybuta-1,3-dien-2-yloxy)ethyl]carbamate;molecular hydrogen (CID 145264017) is tert-butyl N-[2-(3-propoxybuta-1,3-dien-2-yloxy)ethyl]carbamate;molecular hydrogen.
What is the SMILES notation for tert-butyl N-[2-(3-propoxybuta-1,3-dien-2-yloxy)ethyl]carbamate;molecular hydrogen?
The canonical SMILES for tert-butyl N-[2-(3-propoxybuta-1,3-dien-2-yloxy)ethyl]carbamate;molecular hydrogen is C=C(OCCC)C(=C)OCCNC(=O)OC(C)(C)C.[H][H].
What is the InChIKey of tert-butyl N-[2-(3-propoxybuta-1,3-dien-2-yloxy)ethyl]carbamate;molecular hydrogen?
The InChIKey is OEZNWFYNRWHQIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25NO4.H2/c1-7-9-17-11(2)12(3)18-10-8-15-13(16)19-14(4,5)6;/h2-3,7-10H2,1,4-6H3,(H,15,16);1H.
What are the key properties of tert-butyl N-[2-(3-propoxybuta-1,3-dien-2-yloxy)ethyl]carbamate;molecular hydrogen?
tert-butyl N-[2-(3-propoxybuta-1,3-dien-2-yloxy)ethyl]carbamate;molecular hydrogen has a molecular weight of 273.37 g/mol, XLogP of 3.23, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-(3-propoxybuta-1,3-dien-2-yloxy)ethyl]carbamate;molecular hydrogen is sourced from PubChem (CID 145264017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).