C17H20N2O3 — CID 145264132
7-hexan-3-yl-8-oxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10,12-pentaene-4-carboxylic acid (PubChem CID 145264132) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 7-hexan-3-yl-8-oxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10,12-pentaene-4-carboxylic acid.
| Compound Name | 7-hexan-3-yl-8-oxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10,12-pentaene-4-carboxylic acid |
|---|---|
| PubChem CID | 145264132 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 7-hexan-3-yl-8-oxa-3,11-diazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,10,12-pentaene-4-carboxylic acid |
| SMILES | CCCC(CC)C1Oc2cnccc2-c2[nH]c(C(=O)O)cc21 |
| InChI | InChI=1S/C17H20N2O3/c1-3-5-10(4-2)16-12-8-13(17(20)21)19-15(12)11-6-7-18-9-14(11)22-16/h6-10,16,19H,3-5H2,1-2H3,(H,20,21) |
| InChIKey | NXXDRGFXNZMOAB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |