C10H8O2 — CID 145264144
2,3-dihydrocyclohepta[b]pyran-4-one (PubChem CID 145264144) has the molecular formula C10H8O2 and a molecular weight of 160.17 g/mol. Its IUPAC name is 2,3-dihydrocyclohepta[b]pyran-4-one.
| Compound Name | 2,3-dihydrocyclohepta[b]pyran-4-one |
|---|---|
| PubChem CID | 145264144 |
| Molecular Formula | C10H8O2 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 2,3-dihydrocyclohepta[b]pyran-4-one |
| SMILES | O=C1CCOC2=CC=C=CC=C12 |
| InChI | InChI=1S/C10H8O2/c11-9-6-7-12-10-5-3-1-2-4-8(9)10/h2-5H,6-7H2 |
| InChIKey | OPXLNBHJSYFNGJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |