C24H28S — CID 145265122
ethane;4-[(3E,5Z)-nona-1,3,5-trien-4-yl]-8-thiatetracyclo[7.5.0.02,7.012,14]tetradeca-1(9),2(7),3,5,10-pentaene (PubChem CID 145265122) has the molecular formula C24H28S and a molecular weight of 348.56 g/mol. Its IUPAC name is ethane;4-[(3E,5Z)-nona-1,3,5-trien-4-yl]-8-thiatetracyclo[7.5.0.02,7.012,14]tetradeca-1(9),2(7),3,5,10-pentaene.
| Compound Name | ethane;4-[(3E,5Z)-nona-1,3,5-trien-4-yl]-8-thiatetracyclo[7.5.0.02,7.012,14]tetradeca-1(9),2(7),3,5,10-pentaene |
|---|---|
| PubChem CID | 145265122 |
| Molecular Formula | C24H28S |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | ethane;4-[(3E,5Z)-nona-1,3,5-trien-4-yl]-8-thiatetracyclo[7.5.0.02,7.012,14]tetradeca-1(9),2(7),3,5,10-pentaene |
| SMILES | C=C/C=C(\C=C/CCC)c1ccc2sc3c(c2c1)C1CC1C=C3.CC |
| InChI | InChI=1S/C22H22S.C2H6/c1-3-5-6-8-15(7-4-2)16-9-11-20-19(13-16)22-18-14-17(18)10-12-21(22)23-20;1-2/h4,6-13,17-18H,2-3,5,14H2,1H3;1-2H3/b8-6-,15-7+; |
| InChIKey | HYRCGHSZLVUDCY-MMWRLFOHSA-N |
| XLogP | 7.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|