C60H46N6O — CID 145265256
5-[3-(4-cyclohepta-1,4,6-trien-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-12-(2,6-diphenylpyrimidin-4-yl)-[1]benzofuro[2,3-a]carbazole;methane;prop-1-ene (PubChem CID 145265256) has the molecular formula C60H46N6O and a molecular weight of 867.07 g/mol. Its IUPAC name is 5-[3-(4-cyclohepta-1,4,6-trien-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-12-(2,6-diphenylpyrimidin-4-yl)-[1]benzofuro[2,3-a]carbazole;methane;prop-1-ene.
| Compound Name | 5-[3-(4-cyclohepta-1,4,6-trien-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-12-(2,6-diphenylpyrimidin-4-yl)-[1]benzofuro[2,3-a]carbazole;methane;prop-1-ene |
|---|---|
| PubChem CID | 145265256 |
| Molecular Formula | C60H46N6O |
| Molecular Weight | 867.07 g/mol |
| Exact Mass | 866.37 |
| IUPAC Name | 5-[3-(4-cyclohepta-1,4,6-trien-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]-12-(2,6-diphenylpyrimidin-4-yl)-[1]benzofuro[2,3-a]carbazole;methane;prop-1-ene |
| SMILES | C.C1=CCC=C(c2nc(-c3ccccc3)nc(-c3cccc(-c4cc5c6ccccc6oc5c5c4c4ccccc4n5-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)c3)n2)C=C1.C=CC |
| InChI | InChI=1S/C56H36N6O.C3H6.CH4/c1-2-7-22-38(21-6-1)54-59-55(39-25-12-5-13-26-39)61-56(60-54)41-28-18-27-40(33-41)44-34-45-42-29-15-17-32-48(42)63-52(45)51-50(44)43-30-14-16-31-47(43)62(51)49-35-46(36-19-8-3-9-20-36)57-53(58-49)37-23-10-4-11-24-37;1-3-2;/h1-6,8-35H,7H2;3H,1H2,2H3;1H4 |
| InChIKey | GPQMKMZOVRARGY-UHFFFAOYSA-N |
| XLogP | 15.72 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.07 |
| LogP ≤ 5 | 15.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|