C30H30Cl2F3N3OS — CID 145265468
6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfanyl)piperidin-4-yl]amino]quinolin-8-ol;ethane (PubChem CID 145265468) has the molecular formula C30H30Cl2F3N3OS and a molecular weight of 608.56 g/mol. Its IUPAC name is 6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfanyl)piperidin-4-yl]amino]quinolin-8-ol;ethane.
| Compound Name | 6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfanyl)piperidin-4-yl]amino]quinolin-8-ol;ethane |
|---|---|
| PubChem CID | 145265468 |
| Molecular Formula | C30H30Cl2F3N3OS |
| Molecular Weight | 608.56 g/mol |
| Exact Mass | 607.14 |
| IUPAC Name | 6-[bis(4-chlorophenyl)methyl]-4-[[1-(trifluoromethylsulfanyl)piperidin-4-yl]amino]quinolin-8-ol;ethane |
| SMILES | CC.Oc1cc(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc2c(NC3CCN(SC(F)(F)F)CC3)ccnc12 |
| InChI | InChI=1S/C28H24Cl2F3N3OS.C2H6/c29-20-5-1-17(2-6-20)26(18-3-7-21(30)8-4-18)19-15-23-24(9-12-34-27(23)25(37)16-19)35-22-10-13-36(14-11-22)38-28(31,32)33;1-2/h1-9,12,15-16,22,26,37H,10-11,13-14H2,(H,34,35);1-2H3 |
| InChIKey | UVOYRIYERMTIPE-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.56 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|