C27H24Cl2IN3O — CID 145265481
6-[bis(4-chlorophenyl)methyl]-4-[(1-iodopiperidin-4-yl)amino]quinolin-8-ol (PubChem CID 145265481) has the molecular formula C27H24Cl2IN3O and a molecular weight of 604.32 g/mol. Its IUPAC name is 6-[bis(4-chlorophenyl)methyl]-4-[(1-iodopiperidin-4-yl)amino]quinolin-8-ol.
| Compound Name | 6-[bis(4-chlorophenyl)methyl]-4-[(1-iodopiperidin-4-yl)amino]quinolin-8-ol |
|---|---|
| PubChem CID | 145265481 |
| Molecular Formula | C27H24Cl2IN3O |
| Molecular Weight | 604.32 g/mol |
| Exact Mass | 603.03 |
| IUPAC Name | 6-[bis(4-chlorophenyl)methyl]-4-[(1-iodopiperidin-4-yl)amino]quinolin-8-ol |
| SMILES | Oc1cc(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc2c(NC3CCN(I)CC3)ccnc12 |
| InChI | InChI=1S/C27H24Cl2IN3O/c28-20-5-1-17(2-6-20)26(18-3-7-21(29)8-4-18)19-15-23-24(9-12-31-27(23)25(34)16-19)32-22-10-13-33(30)14-11-22/h1-9,12,15-16,22,26,34H,10-11,13-14H2,(H,31,32) |
| InChIKey | BNDZRHASQDAWPK-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.32 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|