About N-ethenyl-N,2-dimethylpropanamide
N-ethenyl-N,2-dimethylpropanamide (PubChem CID 14526638) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is N-ethenyl-N,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-ethenyl-N,2-dimethylpropanamide |
| PubChem CID | 14526638 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | N-ethenyl-N,2-dimethylpropanamide |
| SMILES | C=CN(C)C(=O)C(C)C |
| InChI | InChI=1S/C7H13NO/c1-5-8(4)7(9)6(2)3/h5-6H,1H2,2-4H3 |
| InChIKey | MWAITTXTRUIKOM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethenyl-N,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N,2-dimethylpropanamide?
The IUPAC name of N-ethenyl-N,2-dimethylpropanamide (CID 14526638) is N-ethenyl-N,2-dimethylpropanamide.
What is the SMILES notation for N-ethenyl-N,2-dimethylpropanamide?
The canonical SMILES for N-ethenyl-N,2-dimethylpropanamide is C=CN(C)C(=O)C(C)C.
What is the InChIKey of N-ethenyl-N,2-dimethylpropanamide?
The InChIKey is MWAITTXTRUIKOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO/c1-5-8(4)7(9)6(2)3/h5-6H,1H2,2-4H3.
What are the key properties of N-ethenyl-N,2-dimethylpropanamide?
N-ethenyl-N,2-dimethylpropanamide has a molecular weight of 127.19 g/mol, XLogP of 1.24, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N,2-dimethylpropanamide is sourced from PubChem (CID 14526638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).