About N-[(1E)-buta-1,3-dienyl]-N-propan-2-ylpent-4-enamide
N-[(1E)-buta-1,3-dienyl]-N-propan-2-ylpent-4-enamide (PubChem CID 14526643) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is N-[(1E)-buta-1,3-dienyl]-N-propan-2-ylpent-4-enamide.
Molecular Properties
| Compound Name | N-[(1E)-buta-1,3-dienyl]-N-propan-2-ylpent-4-enamide |
| PubChem CID | 14526643 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | N-[(1E)-buta-1,3-dienyl]-N-propan-2-ylpent-4-enamide |
| SMILES | C=C/C=C/N(C(=O)CCC=C)C(C)C |
| InChI | InChI=1S/C12H19NO/c1-5-7-9-12(14)13(11(3)4)10-8-6-2/h5-6,8,10-11H,1-2,7,9H2,3-4H3/b10-8+ |
| InChIKey | PHZAPCXWRSRMJE-CSKARUKUSA-N |
| XLogP | 2.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1E)-buta-1,3-dienyl]-N-propan-2-ylpent-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1E)-buta-1,3-dienyl]-N-propan-2-ylpent-4-enamide?
The IUPAC name of N-[(1E)-buta-1,3-dienyl]-N-propan-2-ylpent-4-enamide (CID 14526643) is N-[(1E)-buta-1,3-dienyl]-N-propan-2-ylpent-4-enamide.
What is the SMILES notation for N-[(1E)-buta-1,3-dienyl]-N-propan-2-ylpent-4-enamide?
The canonical SMILES for N-[(1E)-buta-1,3-dienyl]-N-propan-2-ylpent-4-enamide is C=C/C=C/N(C(=O)CCC=C)C(C)C.
What is the InChIKey of N-[(1E)-buta-1,3-dienyl]-N-propan-2-ylpent-4-enamide?
The InChIKey is PHZAPCXWRSRMJE-CSKARUKUSA-N. The full InChI is InChI=1S/C12H19NO/c1-5-7-9-12(14)13(11(3)4)10-8-6-2/h5-6,8,10-11H,1-2,7,9H2,3-4H3/b10-8+.
What are the key properties of N-[(1E)-buta-1,3-dienyl]-N-propan-2-ylpent-4-enamide?
N-[(1E)-buta-1,3-dienyl]-N-propan-2-ylpent-4-enamide has a molecular weight of 193.29 g/mol, XLogP of 2.89, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1E)-buta-1,3-dienyl]-N-propan-2-ylpent-4-enamide is sourced from PubChem (CID 14526643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).