C7H6FNO2 — CID 145266889
6-fluoro-5-methyl-3H-1,2,3-benzodioxazole (PubChem CID 145266889) has the molecular formula C7H6FNO2 and a molecular weight of 155.13 g/mol. Its IUPAC name is 6-fluoro-5-methyl-3H-1,2,3-benzodioxazole.
| Compound Name | 6-fluoro-5-methyl-3H-1,2,3-benzodioxazole |
|---|---|
| PubChem CID | 145266889 |
| Molecular Formula | C7H6FNO2 |
| Molecular Weight | 155.13 g/mol |
| Exact Mass | 155.04 |
| IUPAC Name | 6-fluoro-5-methyl-3H-1,2,3-benzodioxazole |
| SMILES | Cc1cc2c(cc1F)OON2 |
| InChI | InChI=1S/C7H6FNO2/c1-4-2-6-7(3-5(4)8)10-11-9-6/h2-3,9H,1H3 |
| InChIKey | DRCBIVKUWVOTPE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.13 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|