About 1-chloro-4-methylbenzene;4-(3,3-dimethylpyrrolidin-1-yl)piperidine;ethane
1-chloro-4-methylbenzene;4-(3,3-dimethylpyrrolidin-1-yl)piperidine;ethane (PubChem CID 145267941) has the molecular formula C26H53ClN2
and a molecular weight of 429.18 g/mol. Its IUPAC name is 1-chloro-4-methylbenzene;4-(3,3-dimethylpyrrolidin-1-yl)piperidine;ethane.
Molecular Properties
| Compound Name | 1-chloro-4-methylbenzene;4-(3,3-dimethylpyrrolidin-1-yl)piperidine;ethane |
| PubChem CID | 145267941 |
| Molecular Formula | C26H53ClN2 |
| Molecular Weight | 429.18 g/mol |
| Exact Mass | 428.39 |
| IUPAC Name | 1-chloro-4-methylbenzene;4-(3,3-dimethylpyrrolidin-1-yl)piperidine;ethane |
| SMILES | CC.CC.CC.CC.CC1(C)CCN(C2CCNCC2)C1.Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H22N2.C7H7Cl.4C2H6/c1-11(2)5-8-13(9-11)10-3-6-12-7-4-10;1-6-2-4-7(8)5-3-6;4*1-2/h10,12H,3-9H2,1-2H3;2-5H,1H3;4*1-2H3 |
| InChIKey | XNWTWKHAYQMBLF-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.18 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chloro-4-methylbenzene;4-(3,3-dimethylpyrrolidin-1-yl)piperidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-4-methylbenzene;4-(3,3-dimethylpyrrolidin-1-yl)piperidine;ethane?
The IUPAC name of 1-chloro-4-methylbenzene;4-(3,3-dimethylpyrrolidin-1-yl)piperidine;ethane (CID 145267941) is 1-chloro-4-methylbenzene;4-(3,3-dimethylpyrrolidin-1-yl)piperidine;ethane.
What is the SMILES notation for 1-chloro-4-methylbenzene;4-(3,3-dimethylpyrrolidin-1-yl)piperidine;ethane?
The canonical SMILES for 1-chloro-4-methylbenzene;4-(3,3-dimethylpyrrolidin-1-yl)piperidine;ethane is CC.CC.CC.CC.CC1(C)CCN(C2CCNCC2)C1.Cc1ccc(Cl)cc1.
What is the InChIKey of 1-chloro-4-methylbenzene;4-(3,3-dimethylpyrrolidin-1-yl)piperidine;ethane?
The InChIKey is XNWTWKHAYQMBLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2.C7H7Cl.4C2H6/c1-11(2)5-8-13(9-11)10-3-6-12-7-4-10;1-6-2-4-7(8)5-3-6;4*1-2/h10,12H,3-9H2,1-2H3;2-5H,1H3;4*1-2H3.
What are the key properties of 1-chloro-4-methylbenzene;4-(3,3-dimethylpyrrolidin-1-yl)piperidine;ethane?
1-chloro-4-methylbenzene;4-(3,3-dimethylpyrrolidin-1-yl)piperidine;ethane has a molecular weight of 429.18 g/mol, XLogP of 8.22, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-4-methylbenzene;4-(3,3-dimethylpyrrolidin-1-yl)piperidine;ethane is sourced from PubChem (CID 145267941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).