C16H19ClN2O3 — CID 145267949
1-chloro-4-methylbenzene;methyl 3-(2-aminoethoxy)pyridine-4-carboxylate (PubChem CID 145267949) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is 1-chloro-4-methylbenzene;methyl 3-(2-aminoethoxy)pyridine-4-carboxylate.
| Compound Name | 1-chloro-4-methylbenzene;methyl 3-(2-aminoethoxy)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 145267949 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 1-chloro-4-methylbenzene;methyl 3-(2-aminoethoxy)pyridine-4-carboxylate |
| SMILES | COC(=O)c1ccncc1OCCN.Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H12N2O3.C7H7Cl/c1-13-9(12)7-2-4-11-6-8(7)14-5-3-10;1-6-2-4-7(8)5-3-6/h2,4,6H,3,5,10H2,1H3;2-5H,1H3 |
| InChIKey | JWLJXCXQOADGKN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |