C33H26F8O4S — CID 145268049
tert-butyl 4-[3-(trifluoromethyl)phenyl]benzoate;7-(2,3,4,5,6-pentafluorophenoxy)sulfanyl-3,4-dihydro-2H-chromene (PubChem CID 145268049) has the molecular formula C33H26F8O4S and a molecular weight of 670.62 g/mol. Its IUPAC name is tert-butyl 4-[3-(trifluoromethyl)phenyl]benzoate;7-(2,3,4,5,6-pentafluorophenoxy)sulfanyl-3,4-dihydro-2H-chromene.
| Compound Name | tert-butyl 4-[3-(trifluoromethyl)phenyl]benzoate;7-(2,3,4,5,6-pentafluorophenoxy)sulfanyl-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 145268049 |
| Molecular Formula | C33H26F8O4S |
| Molecular Weight | 670.62 g/mol |
| Exact Mass | 670.14 |
| IUPAC Name | tert-butyl 4-[3-(trifluoromethyl)phenyl]benzoate;7-(2,3,4,5,6-pentafluorophenoxy)sulfanyl-3,4-dihydro-2H-chromene |
| SMILES | CC(C)(C)OC(=O)c1ccc(-c2cccc(C(F)(F)F)c2)cc1.Fc1c(F)c(F)c(OSc2ccc3c(c2)OCCC3)c(F)c1F |
| InChI | InChI=1S/C18H17F3O2.C15H9F5O2S/c1-17(2,3)23-16(22)13-9-7-12(8-10-13)14-5-4-6-15(11-14)18(19,20)21;16-10-11(17)13(19)15(14(20)12(10)18)22-23-8-4-3-7-2-1-5-21-9(7)6-8/h4-11H,1-3H3;3-4,6H,1-2,5H2 |
| InChIKey | DJDDNUNLXKVCJJ-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.62 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|