C33H24F8O4S — CID 145268087
tert-butyl 4-[2-[7-(2,3,4,5,6-pentafluorophenoxy)sulfanyl-3,4-dihydro-2H-chromen-4-yl]-5-(trifluoromethyl)phenyl]benzoate (PubChem CID 145268087) has the molecular formula C33H24F8O4S and a molecular weight of 668.60 g/mol. Its IUPAC name is tert-butyl 4-[2-[7-(2,3,4,5,6-pentafluorophenoxy)sulfanyl-3,4-dihydro-2H-chromen-4-yl]-5-(trifluoromethyl)phenyl]benzoate.
| Compound Name | tert-butyl 4-[2-[7-(2,3,4,5,6-pentafluorophenoxy)sulfanyl-3,4-dihydro-2H-chromen-4-yl]-5-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 145268087 |
| Molecular Formula | C33H24F8O4S |
| Molecular Weight | 668.60 g/mol |
| Exact Mass | 668.13 |
| IUPAC Name | tert-butyl 4-[2-[7-(2,3,4,5,6-pentafluorophenoxy)sulfanyl-3,4-dihydro-2H-chromen-4-yl]-5-(trifluoromethyl)phenyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(-c2cc(C(F)(F)F)ccc2C2CCOc3cc(SOc4c(F)c(F)c(F)c(F)c4F)ccc32)cc1 |
| InChI | InChI=1S/C33H24F8O4S/c1-32(2,3)44-31(42)17-6-4-16(5-7-17)23-14-18(33(39,40)41)8-10-20(23)21-12-13-43-24-15-19(9-11-22(21)24)46-45-30-28(37)26(35)25(34)27(36)29(30)38/h4-11,14-15,21H,12-13H2,1-3H3 |
| InChIKey | NYZRUWSNDWSWJN-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.60 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|