About ethane;2-(furan-3-yl)-N,4-dimethylaniline
ethane;2-(furan-3-yl)-N,4-dimethylaniline (PubChem CID 145268869) has the molecular formula C16H25NO
and a molecular weight of 247.38 g/mol. Its IUPAC name is ethane;2-(furan-3-yl)-N,4-dimethylaniline.
Molecular Properties
| Compound Name | ethane;2-(furan-3-yl)-N,4-dimethylaniline |
| PubChem CID | 145268869 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | ethane;2-(furan-3-yl)-N,4-dimethylaniline |
| SMILES | CC.CC.CNc1ccc(C)cc1-c1ccoc1 |
| InChI | InChI=1S/C12H13NO.2C2H6/c1-9-3-4-12(13-2)11(7-9)10-5-6-14-8-10;2*1-2/h3-8,13H,1-2H3;2*1-2H3 |
| InChIKey | FCXVSKKQYOLXQD-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-(furan-3-yl)-N,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(furan-3-yl)-N,4-dimethylaniline?
The IUPAC name of ethane;2-(furan-3-yl)-N,4-dimethylaniline (CID 145268869) is ethane;2-(furan-3-yl)-N,4-dimethylaniline.
What is the SMILES notation for ethane;2-(furan-3-yl)-N,4-dimethylaniline?
The canonical SMILES for ethane;2-(furan-3-yl)-N,4-dimethylaniline is CC.CC.CNc1ccc(C)cc1-c1ccoc1.
What is the InChIKey of ethane;2-(furan-3-yl)-N,4-dimethylaniline?
The InChIKey is FCXVSKKQYOLXQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO.2C2H6/c1-9-3-4-12(13-2)11(7-9)10-5-6-14-8-10;2*1-2/h3-8,13H,1-2H3;2*1-2H3.
What are the key properties of ethane;2-(furan-3-yl)-N,4-dimethylaniline?
ethane;2-(furan-3-yl)-N,4-dimethylaniline has a molecular weight of 247.38 g/mol, XLogP of 5.35, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(furan-3-yl)-N,4-dimethylaniline is sourced from PubChem (CID 145268869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).