C11H20N4O — CID 145268943
cyclohexanamine;4-(methylamino)-1H-pyrimidin-6-one (PubChem CID 145268943) has the molecular formula C11H20N4O and a molecular weight of 224.31 g/mol. Its IUPAC name is cyclohexanamine;4-(methylamino)-1H-pyrimidin-6-one.
| Compound Name | cyclohexanamine;4-(methylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 145268943 |
| Molecular Formula | C11H20N4O |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | cyclohexanamine;4-(methylamino)-1H-pyrimidin-6-one |
| SMILES | CNc1cc(=O)[nH]cn1.NC1CCCCC1 |
| InChI | InChI=1S/C6H13N.C5H7N3O/c7-6-4-2-1-3-5-6;1-6-4-2-5(9)8-3-7-4/h6H,1-5,7H2;2-3H,1H3,(H2,6,7,8,9) |
| InChIKey | ABWLSHHRHUXPSU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |